About methane;methanethiol;N-(methylaminomethyl)propanamide
methane;methanethiol;N-(methylaminomethyl)propanamide (PubChem CID 143701183) has the molecular formula C7H20N2OS
and a molecular weight of 180.32 g/mol. Its IUPAC name is methane;methanethiol;N-(methylaminomethyl)propanamide.
Molecular Properties
| Compound Name | methane;methanethiol;N-(methylaminomethyl)propanamide |
| PubChem CID | 143701183 |
| Molecular Formula | C7H20N2OS |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | methane;methanethiol;N-(methylaminomethyl)propanamide |
| SMILES | C.CCC(=O)NCNC.CS |
| InChI | InChI=1S/C5H12N2O.CH4S.CH4/c1-3-5(8)7-4-6-2;1-2;/h6H,3-4H2,1-2H3,(H,7,8);2H,1H3;1H4 |
| InChIKey | VPGOGKSJZCJHKR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methane;methanethiol;N-(methylaminomethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methanethiol;N-(methylaminomethyl)propanamide?
The IUPAC name of methane;methanethiol;N-(methylaminomethyl)propanamide (CID 143701183) is methane;methanethiol;N-(methylaminomethyl)propanamide.
What is the SMILES notation for methane;methanethiol;N-(methylaminomethyl)propanamide?
The canonical SMILES for methane;methanethiol;N-(methylaminomethyl)propanamide is C.CCC(=O)NCNC.CS.
What is the InChIKey of methane;methanethiol;N-(methylaminomethyl)propanamide?
The InChIKey is VPGOGKSJZCJHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O.CH4S.CH4/c1-3-5(8)7-4-6-2;1-2;/h6H,3-4H2,1-2H3,(H,7,8);2H,1H3;1H4.
What are the key properties of methane;methanethiol;N-(methylaminomethyl)propanamide?
methane;methanethiol;N-(methylaminomethyl)propanamide has a molecular weight of 180.32 g/mol, XLogP of 0.87, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methanethiol;N-(methylaminomethyl)propanamide is sourced from PubChem (CID 143701183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).