C27H25Cl2N3O4 — CID 175228703
methyl 2-[[6-chloro-5-[1-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carbonyl]amino]acetate (PubChem CID 175228703) has the molecular formula C27H25Cl2N3O4 and a molecular weight of 526.42 g/mol. Its IUPAC name is methyl 2-[[6-chloro-5-[1-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[6-chloro-5-[1-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 175228703 |
| Molecular Formula | C27H25Cl2N3O4 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | methyl 2-[[6-chloro-5-[1-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1nc(Cl)c(C2=CCN(c3ccc(Cl)cc3)CC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H25Cl2N3O4/c1-35-24(33)16-30-27(34)25-23(36-17-18-5-3-2-4-6-18)15-22(26(29)31-25)19-11-13-32(14-12-19)21-9-7-20(28)8-10-21/h2-11,15H,12-14,16-17H2,1H3,(H,30,34) |
| InChIKey | JXCYXTWBDFRUSY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|