C27H26ClN3O4 — CID 175523318
(2-aminoacetyl) 5-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carboxylate (PubChem CID 175523318) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is (2-aminoacetyl) 5-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carboxylate.
| Compound Name | (2-aminoacetyl) 5-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 175523318 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (2-aminoacetyl) 5-[1-[(4-chlorophenyl)methyl]-3,6-dihydro-2H-pyridin-4-yl]-3-phenylmethoxypyridine-2-carboxylate |
| SMILES | NCC(=O)OC(=O)c1ncc(C2=CCN(Cc3ccc(Cl)cc3)CC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H26ClN3O4/c28-23-8-6-19(7-9-23)17-31-12-10-21(11-13-31)22-14-24(34-18-20-4-2-1-3-5-20)26(30-16-22)27(33)35-25(32)15-29/h1-10,14,16H,11-13,15,17-18,29H2 |
| InChIKey | CFCDUQDSTSCZCX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|