About 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one
3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one (PubChem CID 10151320) has the molecular formula C25H21ClN2O
and a molecular weight of 400.91 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one.
Molecular Properties
| Compound Name | 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one |
| PubChem CID | 10151320 |
| Molecular Formula | C25H21ClN2O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one |
| SMILES | O=c1[nH]c2cc(CN3CC=C(c4ccc(Cl)cc4)CC3)ccc2c2ccccc12 |
| InChI | InChI=1S/C25H21ClN2O/c26-20-8-6-18(7-9-20)19-11-13-28(14-12-19)16-17-5-10-22-21-3-1-2-4-23(21)25(29)27-24(22)15-17/h1-11,15H,12-14,16H2,(H,27,29) |
| InChIKey | PWKNARCXOSDABO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one?
The IUPAC name of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one (CID 10151320) is 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one.
What is the SMILES notation for 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one?
The canonical SMILES for 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one is O=c1[nH]c2cc(CN3CC=C(c4ccc(Cl)cc4)CC3)ccc2c2ccccc12.
What is the InChIKey of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one?
The InChIKey is PWKNARCXOSDABO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21ClN2O/c26-20-8-6-18(7-9-20)19-11-13-28(14-12-19)16-17-5-10-22-21-3-1-2-4-23(21)25(29)27-24(22)15-17/h1-11,15H,12-14,16H2,(H,27,29).
What are the key properties of 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one?
3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one has a molecular weight of 400.91 g/mol, XLogP of 5.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-5H-phenanthridin-6-one is sourced from PubChem (CID 10151320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).