C18H30N2O3 — CID 175228879
3-methyl-1-undecyl-2H-furo[2,3-d]imidazole-2-carboxylic acid (PubChem CID 175228879) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-methyl-1-undecyl-2H-furo[2,3-d]imidazole-2-carboxylic acid.
| Compound Name | 3-methyl-1-undecyl-2H-furo[2,3-d]imidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 175228879 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 3-methyl-1-undecyl-2H-furo[2,3-d]imidazole-2-carboxylic acid |
| SMILES | CCCCCCCCCCCN1c2ccoc2N(C)C1C(=O)O |
| InChI | InChI=1S/C18H30N2O3/c1-3-4-5-6-7-8-9-10-11-13-20-15-12-14-23-17(15)19(2)16(20)18(21)22/h12,14,16H,3-11,13H2,1-2H3,(H,21,22) |
| InChIKey | XGUPYTNBEDEQCZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|