C19H25NO3 — CID 175229978
4-[[4-[(E)-prop-1-enyl]benzoyl]amino]butyl (E)-2-methylbut-2-enoate (PubChem CID 175229978) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-[[4-[(E)-prop-1-enyl]benzoyl]amino]butyl (E)-2-methylbut-2-enoate.
| Compound Name | 4-[[4-[(E)-prop-1-enyl]benzoyl]amino]butyl (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 175229978 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-[[4-[(E)-prop-1-enyl]benzoyl]amino]butyl (E)-2-methylbut-2-enoate |
| SMILES | C/C=C/c1ccc(C(=O)NCCCCOC(=O)/C(C)=C/C)cc1 |
| InChI | InChI=1S/C19H25NO3/c1-4-8-16-9-11-17(12-10-16)18(21)20-13-6-7-14-23-19(22)15(3)5-2/h4-5,8-12H,6-7,13-14H2,1-3H3,(H,20,21)/b8-4+,15-5+ |
| InChIKey | PLSLGQSKUWZOMV-WKHPCKQLSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|