C9H15N3O2 — CID 175231386
3-(pentylamino)-1H-pyrimidine-2,4-dione (PubChem CID 175231386) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-(pentylamino)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(pentylamino)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175231386 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-(pentylamino)-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCNn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C9H15N3O2/c1-2-3-4-6-11-12-8(13)5-7-10-9(12)14/h5,7,11H,2-4,6H2,1H3,(H,10,14) |
| InChIKey | ATZMVJMIGGUTAE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|