C11H18N6O4 — CID 101161492
1-(dimethylcarbamoylamino)-1-[(2,4-dioxopyrimidin-1-yl)methyl]-3,3-dimethylurea (PubChem CID 101161492) has the molecular formula C11H18N6O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-(dimethylcarbamoylamino)-1-[(2,4-dioxopyrimidin-1-yl)methyl]-3,3-dimethylurea.
| Compound Name | 1-(dimethylcarbamoylamino)-1-[(2,4-dioxopyrimidin-1-yl)methyl]-3,3-dimethylurea |
|---|---|
| PubChem CID | 101161492 |
| Molecular Formula | C11H18N6O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-(dimethylcarbamoylamino)-1-[(2,4-dioxopyrimidin-1-yl)methyl]-3,3-dimethylurea |
| SMILES | CN(C)C(=O)NN(Cn1ccc(=O)[nH]c1=O)C(=O)N(C)C |
| InChI | InChI=1S/C11H18N6O4/c1-14(2)10(20)13-17(11(21)15(3)4)7-16-6-5-8(18)12-9(16)19/h5-6H,7H2,1-4H3,(H,13,20)(H,12,18,19) |
| InChIKey | UHXSMHDEWQDCGP-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|