C15H22FNO6S — CID 175231637
tert-butyl N-[3-(2-fluoro-3-methylsulfonylphenoxy)-2-hydroxypropyl]carbamate (PubChem CID 175231637) has the molecular formula C15H22FNO6S and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl N-[3-(2-fluoro-3-methylsulfonylphenoxy)-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-fluoro-3-methylsulfonylphenoxy)-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 175231637 |
| Molecular Formula | C15H22FNO6S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | tert-butyl N-[3-(2-fluoro-3-methylsulfonylphenoxy)-2-hydroxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(O)COc1cccc(S(C)(=O)=O)c1F |
| InChI | InChI=1S/C15H22FNO6S/c1-15(2,3)23-14(19)17-8-10(18)9-22-11-6-5-7-12(13(11)16)24(4,20)21/h5-7,10,18H,8-9H2,1-4H3,(H,17,19) |
| InChIKey | FWQQOYMVBLHSRL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |