C25H29N3O2 — CID 175231940
(4S)-1-benzyl-2,6-dimethyl-4-(3-nitrophenyl)-3-(pyrrolidin-3-ylmethyl)-4H-pyridine (PubChem CID 175231940) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is (4S)-1-benzyl-2,6-dimethyl-4-(3-nitrophenyl)-3-(pyrrolidin-3-ylmethyl)-4H-pyridine.
| Compound Name | (4S)-1-benzyl-2,6-dimethyl-4-(3-nitrophenyl)-3-(pyrrolidin-3-ylmethyl)-4H-pyridine |
|---|---|
| PubChem CID | 175231940 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | (4S)-1-benzyl-2,6-dimethyl-4-(3-nitrophenyl)-3-(pyrrolidin-3-ylmethyl)-4H-pyridine |
| SMILES | CC1=C[C@@H](c2cccc([N+](=O)[O-])c2)C(CC2CCNC2)=C(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H29N3O2/c1-18-13-25(22-9-6-10-23(15-22)28(29)30)24(14-21-11-12-26-16-21)19(2)27(18)17-20-7-4-3-5-8-20/h3-10,13,15,21,25-26H,11-12,14,16-17H2,1-2H3/t21?,25-/m0/s1 |
| InChIKey | YAVORYZVIHIKRI-QBGQUKIHSA-N |
| XLogP | 5.37 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|