C25H28N2O2 — CID 70493693
2,6-dimethyl-4-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-1-propan-2-yl-4H-pyridine (PubChem CID 70493693) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2,6-dimethyl-4-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-1-propan-2-yl-4H-pyridine.
| Compound Name | 2,6-dimethyl-4-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-1-propan-2-yl-4H-pyridine |
|---|---|
| PubChem CID | 70493693 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 2,6-dimethyl-4-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-1-propan-2-yl-4H-pyridine |
| SMILES | CC1=CC(c2cccc([N+](=O)[O-])c2)C(CC=Cc2ccccc2)=C(C)N1C(C)C |
| InChI | InChI=1S/C25H28N2O2/c1-18(2)26-19(3)16-25(22-13-9-14-23(17-22)27(28)29)24(20(26)4)15-8-12-21-10-6-5-7-11-21/h5-14,16-18,25H,15H2,1-4H3 |
| InChIKey | NALFVXGUJNXUMA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|