C26H22N2O5 — CID 163208770
4-hydroxy-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-2H-pyrrol-5-one (PubChem CID 163208770) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-hydroxy-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 163208770 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-hydroxy-1-(4-methoxyphenyl)-2-(3-nitrophenyl)-3-(3-phenylprop-2-enyl)-2H-pyrrol-5-one |
| SMILES | COc1ccc(N2C(=O)C(O)=C(CC=Cc3ccccc3)C2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H22N2O5/c1-33-22-15-13-20(14-16-22)27-24(19-10-6-11-21(17-19)28(31)32)23(25(29)26(27)30)12-5-9-18-7-3-2-4-8-18/h2-11,13-17,24,29H,12H2,1H3 |
| InChIKey | QWIUUPKPZMSMCJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|