About [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol
[(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol (PubChem CID 175232862) has the molecular formula C12H12F2O2
and a molecular weight of 226.22 g/mol. Its IUPAC name is [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol |
| PubChem CID | 175232862 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol |
| SMILES | OC[C@H]1CCC(c2ccc(F)cc2F)=CO1 |
| InChI | InChI=1S/C12H12F2O2/c13-9-2-4-11(12(14)5-9)8-1-3-10(6-15)16-7-8/h2,4-5,7,10,15H,1,3,6H2/t10-/m1/s1 |
| InChIKey | JPRIZNAFFSCUFI-SNVBAGLBSA-N |
| XLogP | 2.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol?
The IUPAC name of [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol (CID 175232862) is [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol.
What is the SMILES notation for [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol?
The canonical SMILES for [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol is OC[C@H]1CCC(c2ccc(F)cc2F)=CO1.
What is the InChIKey of [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol?
The InChIKey is JPRIZNAFFSCUFI-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H12F2O2/c13-9-2-4-11(12(14)5-9)8-1-3-10(6-15)16-7-8/h2,4-5,7,10,15H,1,3,6H2/t10-/m1/s1.
What are the key properties of [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol?
[(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol has a molecular weight of 226.22 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-5-(2,4-difluorophenyl)-3,4-dihydro-2H-pyran-2-yl]methanol is sourced from PubChem (CID 175232862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).