C11H11F2N — CID 65174225
3-(2,4-difluorophenyl)cyclopent-2-en-1-amine (PubChem CID 65174225) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)cyclopent-2-en-1-amine.
| Compound Name | 3-(2,4-difluorophenyl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 65174225 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-(2,4-difluorophenyl)cyclopent-2-en-1-amine |
| SMILES | NC1C=C(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C11H11F2N/c12-8-2-4-10(11(13)6-8)7-1-3-9(14)5-7/h2,4-6,9H,1,3,14H2 |
| InChIKey | KZKNFUASEHMNNK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |