C7H7Br3O — CID 175233985
2,5,6-tribromo-5-methoxycyclohexa-1,3-diene (PubChem CID 175233985) has the molecular formula C7H7Br3O and a molecular weight of 346.84 g/mol. Its IUPAC name is 2,5,6-tribromo-5-methoxycyclohexa-1,3-diene.
| Compound Name | 2,5,6-tribromo-5-methoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175233985 |
| Molecular Formula | C7H7Br3O |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 343.80 |
| IUPAC Name | 2,5,6-tribromo-5-methoxycyclohexa-1,3-diene |
| SMILES | COC1(Br)C=CC(Br)=CC1Br |
| InChI | InChI=1S/C7H7Br3O/c1-11-7(10)3-2-5(8)4-6(7)9/h2-4,6H,1H3 |
| InChIKey | RNMJZEYOJACBHE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|