C8H12O3Sr — CID 175234836
strontium;hydride;3-(2-methylpropylidene)oxolane-2,5-dione (PubChem CID 175234836) has the molecular formula C8H12O3Sr and a molecular weight of 243.80 g/mol. Its IUPAC name is strontium;hydride;3-(2-methylpropylidene)oxolane-2,5-dione.
| Compound Name | strontium;hydride;3-(2-methylpropylidene)oxolane-2,5-dione |
|---|---|
| PubChem CID | 175234836 |
| Molecular Formula | C8H12O3Sr |
| Molecular Weight | 243.80 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | strontium;hydride;3-(2-methylpropylidene)oxolane-2,5-dione |
| SMILES | CC(C)C=C1CC(=O)OC1=O.[H-].[H-].[Sr+2] |
| InChI | InChI=1S/C8H10O3.Sr.2H/c1-5(2)3-6-4-7(9)11-8(6)10;;;/h3,5H,4H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | LBQHRRKDXMCNNM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.80 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|