C7H2O6 — CID 163923906
3-(2,4-dioxooxetan-3-ylidene)oxolane-2,5-dione (PubChem CID 163923906) has the molecular formula C7H2O6 and a molecular weight of 182.09 g/mol. Its IUPAC name is 3-(2,4-dioxooxetan-3-ylidene)oxolane-2,5-dione.
| Compound Name | 3-(2,4-dioxooxetan-3-ylidene)oxolane-2,5-dione |
|---|---|
| PubChem CID | 163923906 |
| Molecular Formula | C7H2O6 |
| Molecular Weight | 182.09 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 3-(2,4-dioxooxetan-3-ylidene)oxolane-2,5-dione |
| SMILES | O=C1CC(=C2C(=O)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C7H2O6/c8-3-1-2(5(9)12-3)4-6(10)13-7(4)11/h1H2 |
| InChIKey | RCUMVNIEFSUQAW-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|