C11H12O5 — CID 13383449
spiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydroisochromene]-1',3'-dione (PubChem CID 13383449) has the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydroisochromene]-1',3'-dione.
| Compound Name | spiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydroisochromene]-1',3'-dione |
|---|---|
| PubChem CID | 13383449 |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | spiro[1,3-dioxolane-2,6'-4,5,7,8-tetrahydroisochromene]-1',3'-dione |
| SMILES | O=C1CC2=C(CCC3(C2)OCCO3)C(=O)O1 |
| InChI | InChI=1S/C11H12O5/c12-9-5-7-6-11(14-3-4-15-11)2-1-8(7)10(13)16-9/h1-6H2 |
| InChIKey | CHBWJAPVMIRNKC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|