C22H21F2N3O3 — CID 175235317
2-[3-fluoro-4-[[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenoxy]-N-hydroxyacetamide (PubChem CID 175235317) has the molecular formula C22H21F2N3O3 and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-[3-fluoro-4-[[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenoxy]-N-hydroxyacetamide.
| Compound Name | 2-[3-fluoro-4-[[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenoxy]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 175235317 |
| Molecular Formula | C22H21F2N3O3 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-[3-fluoro-4-[[4-(6-fluoro-1H-indol-3-yl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenoxy]-N-hydroxyacetamide |
| SMILES | O=C(COc1ccc(CN2CC=C(c3c[nH]c4cc(F)ccc34)CC2)c(F)c1)NO |
| InChI | InChI=1S/C22H21F2N3O3/c23-16-2-4-18-19(11-25-21(18)9-16)14-5-7-27(8-6-14)12-15-1-3-17(10-20(15)24)30-13-22(28)26-29/h1-5,9-11,25,29H,6-8,12-13H2,(H,26,28) |
| InChIKey | BOYXQYKXEXVDAC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|