About acetic acid;(2-aminophenyl) carbonochloridate
acetic acid;(2-aminophenyl) carbonochloridate (PubChem CID 175237733) has the molecular formula C9H10ClNO4
and a molecular weight of 231.64 g/mol. Its IUPAC name is acetic acid;(2-aminophenyl) carbonochloridate.
Molecular Properties
| Compound Name | acetic acid;(2-aminophenyl) carbonochloridate |
| PubChem CID | 175237733 |
| Molecular Formula | C9H10ClNO4 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | acetic acid;(2-aminophenyl) carbonochloridate |
| SMILES | CC(=O)O.Nc1ccccc1OC(=O)Cl |
| InChI | InChI=1S/C7H6ClNO2.C2H4O2/c8-7(10)11-6-4-2-1-3-5(6)9;1-2(3)4/h1-4H,9H2;1H3,(H,3,4) |
| InChIKey | AYRAKBQBSHLKLP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(2-aminophenyl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(2-aminophenyl) carbonochloridate?
The IUPAC name of acetic acid;(2-aminophenyl) carbonochloridate (CID 175237733) is acetic acid;(2-aminophenyl) carbonochloridate.
What is the SMILES notation for acetic acid;(2-aminophenyl) carbonochloridate?
The canonical SMILES for acetic acid;(2-aminophenyl) carbonochloridate is CC(=O)O.Nc1ccccc1OC(=O)Cl.
What is the InChIKey of acetic acid;(2-aminophenyl) carbonochloridate?
The InChIKey is AYRAKBQBSHLKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO2.C2H4O2/c8-7(10)11-6-4-2-1-3-5(6)9;1-2(3)4/h1-4H,9H2;1H3,(H,3,4).
What are the key properties of acetic acid;(2-aminophenyl) carbonochloridate?
acetic acid;(2-aminophenyl) carbonochloridate has a molecular weight of 231.64 g/mol, XLogP of 2.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2-aminophenyl) carbonochloridate is sourced from PubChem (CID 175237733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).