About ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate
ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate (PubChem CID 175238109) has the molecular formula C28H25N3O3
and a molecular weight of 451.53 g/mol. Its IUPAC name is ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate |
| PubChem CID | 175238109 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C28H25N3O3/c1-2-34-25(32)20-29-28(33)26-24(19-18-21-12-6-3-7-13-21)31(23-16-10-5-11-17-23)30-27(26)22-14-8-4-9-15-22/h3-19H,2,20H2,1H3,(H,29,33)/b19-18+ |
| InChIKey | ONDBJOZHFUGWQV-VHEBQXMUSA-N |
| XLogP | 5.00 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate?
The IUPAC name of ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate (CID 175238109) is ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate.
What is the SMILES notation for ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate?
The canonical SMILES for ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate is CCOC(=O)CNC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1/C=C/c1ccccc1.
What is the InChIKey of ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate?
The InChIKey is ONDBJOZHFUGWQV-VHEBQXMUSA-N. The full InChI is InChI=1S/C28H25N3O3/c1-2-34-25(32)20-29-28(33)26-24(19-18-21-12-6-3-7-13-21)31(23-16-10-5-11-17-23)30-27(26)22-14-8-4-9-15-22/h3-19H,2,20H2,1H3,(H,29,33)/b19-18+.
What are the key properties of ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate?
ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate has a molecular weight of 451.53 g/mol, XLogP of 5.00, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[1,3-diphenyl-5-[(E)-2-phenylethenyl]pyrazole-4-carbonyl]amino]acetate is sourced from PubChem (CID 175238109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).