C12H8N4O3S — CID 175238932
1-(2H-tetrazol-5-yl)-3-(4-thiophen-2-ylfuran-2-yl)propane-1,2-dione (PubChem CID 175238932) has the molecular formula C12H8N4O3S and a molecular weight of 288.29 g/mol. Its IUPAC name is 1-(2H-tetrazol-5-yl)-3-(4-thiophen-2-ylfuran-2-yl)propane-1,2-dione.
| Compound Name | 1-(2H-tetrazol-5-yl)-3-(4-thiophen-2-ylfuran-2-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 175238932 |
| Molecular Formula | C12H8N4O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(2H-tetrazol-5-yl)-3-(4-thiophen-2-ylfuran-2-yl)propane-1,2-dione |
| SMILES | O=C(Cc1cc(-c2cccs2)co1)C(=O)c1nn[nH]n1 |
| InChI | InChI=1S/C12H8N4O3S/c17-9(11(18)12-13-15-16-14-12)5-8-4-7(6-19-8)10-2-1-3-20-10/h1-4,6H,5H2,(H,13,14,15,16) |
| InChIKey | NMRYRPOVDKLDBF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|