C12H8N4O2S2 — CID 174435453
3-hydroxy-1-(2H-tetrazol-5-yl)-3-(2-thiophen-2-ylthiophen-3-yl)prop-2-en-1-one (PubChem CID 174435453) has the molecular formula C12H8N4O2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-hydroxy-1-(2H-tetrazol-5-yl)-3-(2-thiophen-2-ylthiophen-3-yl)prop-2-en-1-one.
| Compound Name | 3-hydroxy-1-(2H-tetrazol-5-yl)-3-(2-thiophen-2-ylthiophen-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 174435453 |
| Molecular Formula | C12H8N4O2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 3-hydroxy-1-(2H-tetrazol-5-yl)-3-(2-thiophen-2-ylthiophen-3-yl)prop-2-en-1-one |
| SMILES | O=C(C=C(O)c1ccsc1-c1cccs1)c1nn[nH]n1 |
| InChI | InChI=1S/C12H8N4O2S2/c17-8(6-9(18)12-13-15-16-14-12)7-3-5-20-11(7)10-2-1-4-19-10/h1-6,17H,(H,13,14,15,16) |
| InChIKey | KWNHQVPDIUYYAJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|