C18H16BrClN6O4S2 — CID 175239065
5-bromo-3-[(2S,3S,4R,5S,6S)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-3-hydroxy-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-4-yl]pyridine-2-carbonitrile (PubChem CID 175239065) has the molecular formula C18H16BrClN6O4S2 and a molecular weight of 559.86 g/mol. Its IUPAC name is 5-bromo-3-[(2S,3S,4R,5S,6S)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-3-hydroxy-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-4-yl]pyridine-2-carbonitrile.
| Compound Name | 5-bromo-3-[(2S,3S,4R,5S,6S)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-3-hydroxy-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 175239065 |
| Molecular Formula | C18H16BrClN6O4S2 |
| Molecular Weight | 559.86 g/mol |
| Exact Mass | 557.95 |
| IUPAC Name | 5-bromo-3-[(2S,3S,4R,5S,6S)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-3-hydroxy-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-4-yl]pyridine-2-carbonitrile |
| SMILES | CO[C@@H]1[C@H](S)O[C@@H](CO)[C@@H](O)[C@@]1(c1cc(Br)cnc1C#N)n1cc(-c2nc(Cl)cs2)nn1 |
| InChI | InChI=1S/C18H16BrClN6O4S2/c1-29-15-17(31)30-12(6-27)14(28)18(15,9-2-8(19)4-22-10(9)3-21)26-5-11(24-25-26)16-23-13(20)7-32-16/h2,4-5,7,12,14-15,17,27-28,31H,6H2,1H3/t12-,14+,15+,17-,18+/m0/s1 |
| InChIKey | UQSWFYUIWUTJGW-FPHDVWFLSA-N |
| XLogP | 1.85 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.86 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|