C17H17BrClN5O4S2 — CID 175239111
(2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol (PubChem CID 175239111) has the molecular formula C17H17BrClN5O4S2 and a molecular weight of 534.85 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol.
| Compound Name | (2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol |
|---|---|
| PubChem CID | 175239111 |
| Molecular Formula | C17H17BrClN5O4S2 |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 532.96 |
| IUPAC Name | (2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-4-[4-(4-chloro-1,3-thiazol-2-yl)triazol-1-yl]-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol |
| SMILES | CO[C@@H]1[C@H](S)O[C@@H](CO)[C@@H](O)[C@@]1(c1cncc(Br)c1)n1cc(-c2nc(Cl)cs2)nn1 |
| InChI | InChI=1S/C17H17BrClN5O4S2/c1-27-14-16(29)28-11(6-25)13(26)17(14,8-2-9(18)4-20-3-8)24-5-10(22-23-24)15-21-12(19)7-30-15/h2-5,7,11,13-14,16,25-26,29H,6H2,1H3/t11-,13+,14+,16-,17+/m0/s1 |
| InChIKey | NKRSGXISMLZAHI-WEBKGQRMSA-N |
| XLogP | 1.98 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|