C19H16BrF3N4O7S2 — CID 146487569
[(2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-3,5-dihydroxy-6-sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl hydrogen sulfate (PubChem CID 146487569) has the molecular formula C19H16BrF3N4O7S2 and a molecular weight of 613.39 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-3,5-dihydroxy-6-sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-3,5-dihydroxy-6-sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 146487569 |
| Molecular Formula | C19H16BrF3N4O7S2 |
| Molecular Weight | 613.39 g/mol |
| Exact Mass | 611.96 |
| IUPAC Name | [(2S,3S,4R,5S,6S)-4-(5-bromo-3-pyridinyl)-3,5-dihydroxy-6-sulfanyl-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]methyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OC[C@@H]1O[C@@H](S)[C@@H](O)[C@](c2cncc(Br)c2)(n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@@H]1O |
| InChI | InChI=1S/C19H16BrF3N4O7S2/c20-10-3-9(4-24-5-10)19(16(28)14(7-33-36(30,31)32)34-18(35)17(19)29)27-6-13(25-26-27)8-1-11(21)15(23)12(22)2-8/h1-6,14,16-18,28-29,35H,7H2,(H,30,31,32)/t14-,16+,17+,18-,19+/m0/s1 |
| InChIKey | KVXSDGGVFIBJBB-SXXASDTRSA-N |
| XLogP | 1.46 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|