C12H15ClN4O4S — CID 175169543
(2R,3R,5R,6R)-4-azido-4-(5-chloro-3-pyridinyl)-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol (PubChem CID 175169543) has the molecular formula C12H15ClN4O4S and a molecular weight of 346.80 g/mol. Its IUPAC name is (2R,3R,5R,6R)-4-azido-4-(5-chloro-3-pyridinyl)-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol.
| Compound Name | (2R,3R,5R,6R)-4-azido-4-(5-chloro-3-pyridinyl)-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol |
|---|---|
| PubChem CID | 175169543 |
| Molecular Formula | C12H15ClN4O4S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (2R,3R,5R,6R)-4-azido-4-(5-chloro-3-pyridinyl)-2-(hydroxymethyl)-5-methoxy-6-sulfanyloxan-3-ol |
| SMILES | CO[C@H]1[C@@H](S)O[C@H](CO)[C@H](O)C1(N=[N+]=[N-])c1cncc(Cl)c1 |
| InChI | InChI=1S/C12H15ClN4O4S/c1-20-10-11(22)21-8(5-18)9(19)12(10,16-17-14)6-2-7(13)4-15-3-6/h2-4,8-11,18-19,22H,5H2,1H3/t8-,9+,10+,11-,12?/m1/s1 |
| InChIKey | AKMNUINHWHLZHD-SCWFEDMQSA-N |
| XLogP | 1.26 |
| TPSA | 120.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|