C12H17NO3S2 — CID 175239118
3-(2-methylthiophen-3-yl)prop-2-enoic acid;N-(2-sulfanylethyl)acetamide (PubChem CID 175239118) has the molecular formula C12H17NO3S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-(2-methylthiophen-3-yl)prop-2-enoic acid;N-(2-sulfanylethyl)acetamide.
| Compound Name | 3-(2-methylthiophen-3-yl)prop-2-enoic acid;N-(2-sulfanylethyl)acetamide |
|---|---|
| PubChem CID | 175239118 |
| Molecular Formula | C12H17NO3S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-(2-methylthiophen-3-yl)prop-2-enoic acid;N-(2-sulfanylethyl)acetamide |
| SMILES | CC(=O)NCCS.Cc1sccc1C=CC(=O)O |
| InChI | InChI=1S/C8H8O2S.C4H9NOS/c1-6-7(4-5-11-6)2-3-8(9)10;1-4(6)5-2-3-7/h2-5H,1H3,(H,9,10);7H,2-3H2,1H3,(H,5,6) |
| InChIKey | LSCLLQHJFDQAJD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|