C26H19BrO2 — CID 175241901
3-[(3-bromophenyl)methyl]-1-methyl-1H-chrysene-2,4-dione (PubChem CID 175241901) has the molecular formula C26H19BrO2 and a molecular weight of 443.34 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methyl]-1-methyl-1H-chrysene-2,4-dione.
| Compound Name | 3-[(3-bromophenyl)methyl]-1-methyl-1H-chrysene-2,4-dione |
|---|---|
| PubChem CID | 175241901 |
| Molecular Formula | C26H19BrO2 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 3-[(3-bromophenyl)methyl]-1-methyl-1H-chrysene-2,4-dione |
| SMILES | CC1C(=O)C(Cc2cccc(Br)c2)C(=O)c2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C26H19BrO2/c1-15-19-11-12-21-20-8-3-2-6-17(20)9-10-22(21)24(19)26(29)23(25(15)28)14-16-5-4-7-18(27)13-16/h2-13,15,23H,14H2,1H3 |
| InChIKey | HVTKOXLQZMFGQV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|