C29H24N2O4 — CID 174732987
1,3-bis(prop-2-enyl)-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid (PubChem CID 174732987) has the molecular formula C29H24N2O4 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid.
| Compound Name | 1,3-bis(prop-2-enyl)-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 174732987 |
| Molecular Formula | C29H24N2O4 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid |
| SMILES | C=CCC1C(=O)c2c(ccc3c2ccc2ccccc23)C(CC=C)C1=O.O=C(O)c1cncnc1 |
| InChI | InChI=1S/C24H20O2.C5H4N2O2/c1-3-7-20-19-14-13-17-16-10-6-5-9-15(16)11-12-18(17)22(19)24(26)21(8-4-2)23(20)25;8-5(9)4-1-6-3-7-2-4/h3-6,9-14,20-21H,1-2,7-8H2;1-3H,(H,8,9) |
| InChIKey | VNYRUECZSNRBMK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|