About 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid
1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid (PubChem CID 174733115) has the molecular formula C27H24N2O4
and a molecular weight of 440.50 g/mol. Its IUPAC name is 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid |
| PubChem CID | 174733115 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid |
| SMILES | CCC1C(=O)c2c(ccc3c2ccc2ccccc23)C(CC)C1=O.O=C(O)c1cncnc1 |
| InChI | InChI=1S/C22H20O2.C5H4N2O2/c1-3-14-18-12-11-17-16-8-6-5-7-13(16)9-10-19(17)20(18)22(24)15(4-2)21(14)23;8-5(9)4-1-6-3-7-2-4/h5-12,14-15H,3-4H2,1-2H3;1-3H,(H,8,9) |
| InChIKey | KVYOOHQFXVVIOU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid?
The IUPAC name of 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid (CID 174733115) is 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid.
What is the SMILES notation for 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid?
The canonical SMILES for 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid is CCC1C(=O)c2c(ccc3c2ccc2ccccc23)C(CC)C1=O.O=C(O)c1cncnc1.
What is the InChIKey of 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid?
The InChIKey is KVYOOHQFXVVIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O2.C5H4N2O2/c1-3-14-18-12-11-17-16-8-6-5-7-13(16)9-10-19(17)20(18)22(24)15(4-2)21(14)23;8-5(9)4-1-6-3-7-2-4/h5-12,14-15H,3-4H2,1-2H3;1-3H,(H,8,9).
What are the key properties of 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid?
1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid has a molecular weight of 440.50 g/mol, XLogP of 5.45, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid is sourced from PubChem (CID 174733115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).