C27H24N2O4 — CID 174733115
1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid (PubChem CID 174733115) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid.
| Compound Name | 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 174733115 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 1,3-diethyl-1H-chrysene-2,4-dione;pyrimidine-5-carboxylic acid |
| SMILES | CCC1C(=O)c2c(ccc3c2ccc2ccccc23)C(CC)C1=O.O=C(O)c1cncnc1 |
| InChI | InChI=1S/C22H20O2.C5H4N2O2/c1-3-14-18-12-11-17-16-8-6-5-7-13(16)9-10-19(17)20(18)22(24)15(4-2)21(14)23;8-5(9)4-1-6-3-7-2-4/h5-12,14-15H,3-4H2,1-2H3;1-3H,(H,8,9) |
| InChIKey | KVYOOHQFXVVIOU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|