C38H25F3N2O5S — CID 174818286
[1-(4-methylsulfinylphenyl)-2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]chrysen-1-yl] pyrimidine-5-carboxylate (PubChem CID 174818286) has the molecular formula C38H25F3N2O5S and a molecular weight of 678.69 g/mol. Its IUPAC name is [1-(4-methylsulfinylphenyl)-2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]chrysen-1-yl] pyrimidine-5-carboxylate.
| Compound Name | [1-(4-methylsulfinylphenyl)-2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]chrysen-1-yl] pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 174818286 |
| Molecular Formula | C38H25F3N2O5S |
| Molecular Weight | 678.69 g/mol |
| Exact Mass | 678.14 |
| IUPAC Name | [1-(4-methylsulfinylphenyl)-2,4-dioxo-3-[[3-(trifluoromethyl)phenyl]methyl]chrysen-1-yl] pyrimidine-5-carboxylate |
| SMILES | CS(=O)c1ccc(C2(OC(=O)c3cncnc3)C(=O)C(Cc3cccc(C(F)(F)F)c3)C(=O)c3c2ccc2c3ccc3ccccc32)cc1 |
| InChI | InChI=1S/C38H25F3N2O5S/c1-49(47)27-12-10-25(11-13-27)37(48-36(46)24-19-42-21-43-20-24)32-16-15-29-28-8-3-2-6-23(28)9-14-30(29)33(32)34(44)31(35(37)45)18-22-5-4-7-26(17-22)38(39,40)41/h2-17,19-21,31H,18H2,1H3 |
| InChIKey | JGMVVVXRUCQBFX-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.69 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|