C14H19N3O5 — CID 175243046
(3R,4R)-3-(2-amino-5-methoxycarbonylanilino)-4-methoxypyrrolidine-1-carboxylic acid (PubChem CID 175243046) has the molecular formula C14H19N3O5 and a molecular weight of 309.32 g/mol. Its IUPAC name is (3R,4R)-3-(2-amino-5-methoxycarbonylanilino)-4-methoxypyrrolidine-1-carboxylic acid.
| Compound Name | (3R,4R)-3-(2-amino-5-methoxycarbonylanilino)-4-methoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175243046 |
| Molecular Formula | C14H19N3O5 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (3R,4R)-3-(2-amino-5-methoxycarbonylanilino)-4-methoxypyrrolidine-1-carboxylic acid |
| SMILES | COC(=O)c1ccc(N)c(N[C@@H]2CN(C(=O)O)C[C@H]2OC)c1 |
| InChI | InChI=1S/C14H19N3O5/c1-21-12-7-17(14(19)20)6-11(12)16-10-5-8(13(18)22-2)3-4-9(10)15/h3-5,11-12,16H,6-7,15H2,1-2H3,(H,19,20)/t11-,12-/m1/s1 |
| InChIKey | MYCASGLOGMNDOP-VXGBXAGGSA-N |
| XLogP | 0.84 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|