C17H12ClN3 — CID 175243886
8-chloro-1-(3-methylphenyl)imidazo[4,5-c]quinoline (PubChem CID 175243886) has the molecular formula C17H12ClN3 and a molecular weight of 293.76 g/mol. Its IUPAC name is 8-chloro-1-(3-methylphenyl)imidazo[4,5-c]quinoline.
| Compound Name | 8-chloro-1-(3-methylphenyl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 175243886 |
| Molecular Formula | C17H12ClN3 |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 8-chloro-1-(3-methylphenyl)imidazo[4,5-c]quinoline |
| SMILES | Cc1cccc(-n2cnc3cnc4ccc(Cl)cc4c32)c1 |
| InChI | InChI=1S/C17H12ClN3/c1-11-3-2-4-13(7-11)21-10-20-16-9-19-15-6-5-12(18)8-14(15)17(16)21/h2-10H,1H3 |
| InChIKey | VURZCYRAGUGXCU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |