C21H20BrN5 — CID 69157914
8-bromo-1-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]quinoline (PubChem CID 69157914) has the molecular formula C21H20BrN5 and a molecular weight of 422.33 g/mol. Its IUPAC name is 8-bromo-1-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]quinoline.
| Compound Name | 8-bromo-1-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 69157914 |
| Molecular Formula | C21H20BrN5 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 8-bromo-1-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[4,5-c]quinoline |
| SMILES | CN1CCN(c2ccc(-n3cnc4cnc5ccc(Br)cc5c43)cc2)CC1 |
| InChI | InChI=1S/C21H20BrN5/c1-25-8-10-26(11-9-25)16-3-5-17(6-4-16)27-14-24-20-13-23-19-7-2-15(22)12-18(19)21(20)27/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | IBOSOSRFIOROJO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|