C22H25F2NO5 — CID 175244042
4-[1-[[2-[[3-(difluoromethoxy)phenyl]methoxy]-3-methylbutanoyl]amino]ethyl]benzoic acid (PubChem CID 175244042) has the molecular formula C22H25F2NO5 and a molecular weight of 421.44 g/mol. Its IUPAC name is 4-[1-[[2-[[3-(difluoromethoxy)phenyl]methoxy]-3-methylbutanoyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[2-[[3-(difluoromethoxy)phenyl]methoxy]-3-methylbutanoyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175244042 |
| Molecular Formula | C22H25F2NO5 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-[1-[[2-[[3-(difluoromethoxy)phenyl]methoxy]-3-methylbutanoyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)C(OCc1cccc(OC(F)F)c1)C(C)C)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H25F2NO5/c1-13(2)19(29-12-15-5-4-6-18(11-15)30-22(23)24)20(26)25-14(3)16-7-9-17(10-8-16)21(27)28/h4-11,13-14,19,22H,12H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | MIBWYESBEPDYJJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |