C18H17ClN2OS — CID 175248232
5-[4-(4-chlorophenoxy)piperidin-1-yl]-1,3-benzothiazole (PubChem CID 175248232) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is 5-[4-(4-chlorophenoxy)piperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 5-[4-(4-chlorophenoxy)piperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 175248232 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 5-[4-(4-chlorophenoxy)piperidin-1-yl]-1,3-benzothiazole |
| SMILES | Clc1ccc(OC2CCN(c3ccc4scnc4c3)CC2)cc1 |
| InChI | InChI=1S/C18H17ClN2OS/c19-13-1-4-15(5-2-13)22-16-7-9-21(10-8-16)14-3-6-18-17(11-14)20-12-23-18/h1-6,11-12,16H,7-10H2 |
| InChIKey | BUOGJKVSYATINZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |