C8H15NS — CID 175249788
N,N-diethyl-2,3-dihydrothiophen-3-amine (PubChem CID 175249788) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is N,N-diethyl-2,3-dihydrothiophen-3-amine.
| Compound Name | N,N-diethyl-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 175249788 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N,N-diethyl-2,3-dihydrothiophen-3-amine |
| SMILES | CCN(CC)C1C=CSC1 |
| InChI | InChI=1S/C8H15NS/c1-3-9(4-2)8-5-6-10-7-8/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | CLFQMFXVVQZRJU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |