C4H8Cl2O9P+ — CID 175251788
bis(1-chloro-2,2,2-trihydroxyethoxy)-oxophosphanium (PubChem CID 175251788) has the molecular formula C4H8Cl2O9P+ and a molecular weight of 301.98 g/mol. Its IUPAC name is bis(1-chloro-2,2,2-trihydroxyethoxy)-oxophosphanium.
| Compound Name | bis(1-chloro-2,2,2-trihydroxyethoxy)-oxophosphanium |
|---|---|
| PubChem CID | 175251788 |
| Molecular Formula | C4H8Cl2O9P+ |
| Molecular Weight | 301.98 g/mol |
| Exact Mass | 300.93 |
| IUPAC Name | bis(1-chloro-2,2,2-trihydroxyethoxy)-oxophosphanium |
| SMILES | O=[P+](OC(Cl)C(O)(O)O)OC(Cl)C(O)(O)O |
| InChI | InChI=1S/C4H8Cl2O9P/c5-1(3(7,8)9)14-16(13)15-2(6)4(10,11)12/h1-2,7-12H/q+1 |
| InChIKey | UEVUEPVXJSIAJL-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.98 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|