C17H26O4 — CID 175252005
3-(cyclohexylmethyl)-2-ethyl-2-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid (PubChem CID 175252005) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-2-ethyl-2-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid.
| Compound Name | 3-(cyclohexylmethyl)-2-ethyl-2-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 175252005 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 3-(cyclohexylmethyl)-2-ethyl-2-methyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
| SMILES | CCC1(C)C(CC2CCCCC2)(C(=O)O)CCC23OC21O3 |
| InChI | InChI=1S/C17H26O4/c1-3-14(2)15(13(18)19,11-12-7-5-4-6-8-12)9-10-16-17(14,20-16)21-16/h12H,3-11H2,1-2H3,(H,18,19) |
| InChIKey | YPDGMXMMIFZGMP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|