C16H24O4 — CID 88505184
2-(cyclohexylmethyl)-3,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid (PubChem CID 88505184) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-3,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid.
| Compound Name | 2-(cyclohexylmethyl)-3,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 88505184 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-(cyclohexylmethyl)-3,4-dimethyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylic acid |
| SMILES | CC1CC23OC2(O3)C(CC2CCCCC2)C1(C)C(=O)O |
| InChI | InChI=1S/C16H24O4/c1-10-9-15-16(19-15,20-15)12(14(10,2)13(17)18)8-11-6-4-3-5-7-11/h10-12H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | LTEGWDOBGONDSJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|