C15H20F3N3O3 — CID 175252415
tert-butyl (3S)-2-imino-3-[5-[1-(trifluoromethyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]pentanoate (PubChem CID 175252415) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is tert-butyl (3S)-2-imino-3-[5-[1-(trifluoromethyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]pentanoate.
| Compound Name | tert-butyl (3S)-2-imino-3-[5-[1-(trifluoromethyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]pentanoate |
|---|---|
| PubChem CID | 175252415 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | tert-butyl (3S)-2-imino-3-[5-[1-(trifluoromethyl)cyclopropyl]-1,2,4-oxadiazol-3-yl]pentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)[C@H](CC)c1noc(C2(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C15H20F3N3O3/c1-5-8(9(19)11(22)23-13(2,3)4)10-20-12(24-21-10)14(6-7-14)15(16,17)18/h8,19H,5-7H2,1-4H3/b19-9-/t8-/m0/s1 |
| InChIKey | HVYRITAIFWEXCH-NFAMBCEPSA-N |
| XLogP | 3.52 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|