C16H23N3O5 — CID 174534106
tert-butyl (3S)-3-[5-(1-acetyloxycyclopropyl)-1,2,4-oxadiazol-3-yl]-2-iminopentanoate (PubChem CID 174534106) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl (3S)-3-[5-(1-acetyloxycyclopropyl)-1,2,4-oxadiazol-3-yl]-2-iminopentanoate.
| Compound Name | tert-butyl (3S)-3-[5-(1-acetyloxycyclopropyl)-1,2,4-oxadiazol-3-yl]-2-iminopentanoate |
|---|---|
| PubChem CID | 174534106 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl (3S)-3-[5-(1-acetyloxycyclopropyl)-1,2,4-oxadiazol-3-yl]-2-iminopentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)[C@H](CC)c1noc(C2(OC(C)=O)CC2)n1 |
| InChI | InChI=1S/C16H23N3O5/c1-6-10(11(17)13(21)23-15(3,4)5)12-18-14(24-19-12)16(7-8-16)22-9(2)20/h10,17H,6-8H2,1-5H3/b17-11-/t10-/m0/s1 |
| InChIKey | RVLPVAOVCMJIKB-FVKJSVPQSA-N |
| XLogP | 2.48 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|