C22H28O2 — CID 175253986
[(8R,9S,10R,13R,14S,17S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 175253986) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is [(8R,9S,10R,13R,14S,17S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,10R,13R,14S,17S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 175253986 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(8R,9S,10R,13R,14S,17S)-13-prop-2-ynyl-1,2,7,8,9,10,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | C#CC[C@]12CC[C@H]3[C@@H](CC=C4C=CCC[C@@H]43)[C@@H]1CC[C@@H]2OC(C)=O |
| InChI | InChI=1S/C22H28O2/c1-3-13-22-14-12-18-17-7-5-4-6-16(17)8-9-19(18)20(22)10-11-21(22)24-15(2)23/h1,4,6,8,17-21H,5,7,9-14H2,2H3/t17-,18+,19+,20-,21-,22-/m0/s1 |
| InChIKey | IOUPKTXZUPSQDA-ZCPXKWAGSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|