C11H21N2+ — CID 175255699
1,2,5-triethyl-1,4-dimethylimidazol-1-ium (PubChem CID 175255699) has the molecular formula C11H21N2+ and a molecular weight of 181.30 g/mol. Its IUPAC name is 1,2,5-triethyl-1,4-dimethylimidazol-1-ium.
| Compound Name | 1,2,5-triethyl-1,4-dimethylimidazol-1-ium |
|---|---|
| PubChem CID | 175255699 |
| Molecular Formula | C11H21N2+ |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.17 |
| IUPAC Name | 1,2,5-triethyl-1,4-dimethylimidazol-1-ium |
| SMILES | CCC1=NC(C)=C(CC)[N+]1(C)CC |
| InChI | InChI=1S/C11H21N2/c1-6-10-9(4)12-11(7-2)13(10,5)8-3/h6-8H2,1-5H3/q+1 |
| InChIKey | KMENHZLJMGNACW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|