About acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid
acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid (PubChem CID 175255981) has the molecular formula C11H15BFNO6
and a molecular weight of 287.05 g/mol. Its IUPAC name is acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid.
Molecular Properties
| Compound Name | acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid |
| PubChem CID | 175255981 |
| Molecular Formula | C11H15BFNO6 |
| Molecular Weight | 287.05 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid |
| SMILES | C/N=C/C(=O)O.CC(=O)O.OB(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C6H6BFO2.C3H5NO2.C2H4O2/c8-6-3-1-5(2-4-6)7(9)10;1-4-2-3(5)6;1-2(3)4/h1-4,9-10H;2H,1H3,(H,5,6);1H3,(H,3,4)/b;4-2+; |
| InChIKey | AZENXVUDMOLGOJ-ADXGFCJISA-N |
| XLogP | -0.63 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.05 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid?
The IUPAC name of acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid (CID 175255981) is acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid.
What is the SMILES notation for acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid?
The canonical SMILES for acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid is C/N=C/C(=O)O.CC(=O)O.OB(O)c1ccc(F)cc1.
What is the InChIKey of acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid?
The InChIKey is AZENXVUDMOLGOJ-ADXGFCJISA-N. The full InChI is InChI=1S/C6H6BFO2.C3H5NO2.C2H4O2/c8-6-3-1-5(2-4-6)7(9)10;1-4-2-3(5)6;1-2(3)4/h1-4,9-10H;2H,1H3,(H,5,6);1H3,(H,3,4)/b;4-2+;.
What are the key properties of acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid?
acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid has a molecular weight of 287.05 g/mol, XLogP of -0.63, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(4-fluorophenyl)boronic acid;2-methyliminoacetic acid is sourced from PubChem (CID 175255981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).