C10H15N5O5 — CID 175258661
(2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;7H-purin-2-amine (PubChem CID 175258661) has the molecular formula C10H15N5O5 and a molecular weight of 285.26 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;7H-purin-2-amine.
| Compound Name | (2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;7H-purin-2-amine |
|---|---|
| PubChem CID | 175258661 |
| Molecular Formula | C10H15N5O5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (2R,3R,4S,5R)-5-(hydroxymethyl)oxolane-2,3,4-triol;7H-purin-2-amine |
| SMILES | Nc1ncc2[nH]cnc2n1.OC[C@H]1O[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H5N5.C5H10O5/c6-5-7-1-3-4(10-5)9-2-8-3;6-1-2-3(7)4(8)5(9)10-2/h1-2H,(H3,6,7,8,9,10);2-9H,1H2/t;2-,3-,4-,5-/m.1/s1 |
| InChIKey | RKYAKGHMZXRFLK-CAXHYWHXSA-N |
| XLogP | -2.65 |
| TPSA | 170.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |