C24H23ClN4O3 — CID 175259805
2-[[3-(2-chloro-3-phenylanilino)-1-methylindazol-6-yl]amino]-3-hydroxybutanoic acid (PubChem CID 175259805) has the molecular formula C24H23ClN4O3 and a molecular weight of 450.93 g/mol. Its IUPAC name is 2-[[3-(2-chloro-3-phenylanilino)-1-methylindazol-6-yl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[3-(2-chloro-3-phenylanilino)-1-methylindazol-6-yl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 175259805 |
| Molecular Formula | C24H23ClN4O3 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[[3-(2-chloro-3-phenylanilino)-1-methylindazol-6-yl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(Nc1ccc2c(Nc3cccc(-c4ccccc4)c3Cl)nn(C)c2c1)C(=O)O |
| InChI | InChI=1S/C24H23ClN4O3/c1-14(30)22(24(31)32)26-16-11-12-18-20(13-16)29(2)28-23(18)27-19-10-6-9-17(21(19)25)15-7-4-3-5-8-15/h3-14,22,26,30H,1-2H3,(H,27,28)(H,31,32) |
| InChIKey | LVIPYPNYVQGHPU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |