C27H26ClN5O3 — CID 175259745
N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]methylideneamino]ethyl]acetamide (PubChem CID 175259745) has the molecular formula C27H26ClN5O3 and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]methylideneamino]ethyl]acetamide.
| Compound Name | N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]methylideneamino]ethyl]acetamide |
|---|---|
| PubChem CID | 175259745 |
| Molecular Formula | C27H26ClN5O3 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]methylideneamino]ethyl]acetamide |
| SMILES | CC(=O)NCC/N=C/c1ccc2c(Nc3cccc(-c4ccc5c(c4)OCCO5)c3Cl)nn(C)c2c1 |
| InChI | InChI=1S/C27H26ClN5O3/c1-17(34)30-11-10-29-16-18-6-8-21-23(14-18)33(2)32-27(21)31-22-5-3-4-20(26(22)28)19-7-9-24-25(15-19)36-13-12-35-24/h3-9,14-16H,10-13H2,1-2H3,(H,30,34)(H,31,32)/b29-16+ |
| InChIKey | BHRGIFRDIYOTJS-MUFRIFMGSA-N |
| XLogP | 4.96 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|