C26H26ClN5O3 — CID 175259793
N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]amino]ethyl]acetamide (PubChem CID 175259793) has the molecular formula C26H26ClN5O3 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 175259793 |
| Molecular Formula | C26H26ClN5O3 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | N-[2-[[3-[2-chloro-3-(2,3-dihydro-1,4-benzodioxin-6-yl)anilino]-1-methylindazol-6-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ccc2c(Nc3cccc(-c4ccc5c(c4)OCCO5)c3Cl)nn(C)c2c1 |
| InChI | InChI=1S/C26H26ClN5O3/c1-16(33)28-10-11-29-18-7-8-20-22(15-18)32(2)31-26(20)30-21-5-3-4-19(25(21)27)17-6-9-23-24(14-17)35-13-12-34-23/h3-9,14-15,29H,10-13H2,1-2H3,(H,28,33)(H,30,31) |
| InChIKey | AMGUSUODJYWGRD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|